C24H39N5O3 — CID 146300504
3-[[3-methyl-2-methylidene-3-[(1S,2S)-2-[(1-propan-2-ylpyrazol-4-yl)methylamino]cyclohexyl]oxybutyl]amino]piperidine-2,6-dione (PubChem CID 146300504) has the molecular formula C24H39N5O3 and a molecular weight of 445.61 g/mol. Its IUPAC name is 3-[[3-methyl-2-methylidene-3-[(1S,2S)-2-[(1-propan-2-ylpyrazol-4-yl)methylamino]cyclohexyl]oxybutyl]amino]piperidine-2,6-dione.
| Compound Name | 3-[[3-methyl-2-methylidene-3-[(1S,2S)-2-[(1-propan-2-ylpyrazol-4-yl)methylamino]cyclohexyl]oxybutyl]amino]piperidine-2,6-dione |
|---|---|
| PubChem CID | 146300504 |
| Molecular Formula | C24H39N5O3 |
| Molecular Weight | 445.61 g/mol |
| Exact Mass | 445.31 |
| IUPAC Name | 3-[[3-methyl-2-methylidene-3-[(1S,2S)-2-[(1-propan-2-ylpyrazol-4-yl)methylamino]cyclohexyl]oxybutyl]amino]piperidine-2,6-dione |
| SMILES | C=C(CNC1CCC(=O)NC1=O)C(C)(C)O[C@H]1CCCC[C@@H]1NCc1cnn(C(C)C)c1 |
| InChI | InChI=1S/C24H39N5O3/c1-16(2)29-15-18(14-27-29)13-26-19-8-6-7-9-21(19)32-24(4,5)17(3)12-25-20-10-11-22(30)28-23(20)31/h14-16,19-21,25-26H,3,6-13H2,1-2,4-5H3,(H,28,30,31)/t19-,20?,21-/m0/s1 |
| InChIKey | ZBENNUHJMVQYSS-YSTUSHMSSA-N |
| XLogP | 2.61 |
| TPSA | 97.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.61 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|