C15H25NO — CID 146300647
1-[2-[(2E,4Z)-6-methylhepta-2,4,6-trien-2-yl]oxyethyl]piperidine (PubChem CID 146300647) has the molecular formula C15H25NO and a molecular weight of 235.37 g/mol. Its IUPAC name is 1-[2-[(2E,4Z)-6-methylhepta-2,4,6-trien-2-yl]oxyethyl]piperidine.
| Compound Name | 1-[2-[(2E,4Z)-6-methylhepta-2,4,6-trien-2-yl]oxyethyl]piperidine |
|---|---|
| PubChem CID | 146300647 |
| Molecular Formula | C15H25NO |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.19 |
| IUPAC Name | 1-[2-[(2E,4Z)-6-methylhepta-2,4,6-trien-2-yl]oxyethyl]piperidine |
| SMILES | C=C(C)/C=C\C=C(/C)OCCN1CCCCC1 |
| InChI | InChI=1S/C15H25NO/c1-14(2)8-7-9-15(3)17-13-12-16-10-5-4-6-11-16/h7-9H,1,4-6,10-13H2,2-3H3/b8-7-,15-9+ |
| InChIKey | KFMLTEATFVFGFA-USTJKHOZSA-N |
| XLogP | 3.53 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|