C12H11ClN4O3S — CID 146301354
4-amino-N-(6-chloro-3-pyridinyl)-3-sulfamoylbenzamide (PubChem CID 146301354) has the molecular formula C12H11ClN4O3S and a molecular weight of 326.77 g/mol. Its IUPAC name is 4-amino-N-(6-chloro-3-pyridinyl)-3-sulfamoylbenzamide.
| Compound Name | 4-amino-N-(6-chloro-3-pyridinyl)-3-sulfamoylbenzamide |
|---|---|
| PubChem CID | 146301354 |
| Molecular Formula | C12H11ClN4O3S |
| Molecular Weight | 326.77 g/mol |
| Exact Mass | 326.02 |
| IUPAC Name | 4-amino-N-(6-chloro-3-pyridinyl)-3-sulfamoylbenzamide |
| SMILES | Nc1ccc(C(=O)Nc2ccc(Cl)nc2)cc1S(N)(=O)=O |
| InChI | InChI=1S/C12H11ClN4O3S/c13-11-4-2-8(6-16-11)17-12(18)7-1-3-9(14)10(5-7)21(15,19)20/h1-6H,14H2,(H,17,18)(H2,15,19,20) |
| InChIKey | IABFAKHXOVRWBJ-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 128.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.77 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|