C12H9F3N4O3S — CID 146301421
6-amino-5-sulfamoyl-N-(3,4,5-trifluorophenyl)pyridine-3-carboxamide (PubChem CID 146301421) has the molecular formula C12H9F3N4O3S and a molecular weight of 346.29 g/mol. Its IUPAC name is 6-amino-5-sulfamoyl-N-(3,4,5-trifluorophenyl)pyridine-3-carboxamide.
| Compound Name | 6-amino-5-sulfamoyl-N-(3,4,5-trifluorophenyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 146301421 |
| Molecular Formula | C12H9F3N4O3S |
| Molecular Weight | 346.29 g/mol |
| Exact Mass | 346.03 |
| IUPAC Name | 6-amino-5-sulfamoyl-N-(3,4,5-trifluorophenyl)pyridine-3-carboxamide |
| SMILES | Nc1ncc(C(=O)Nc2cc(F)c(F)c(F)c2)cc1S(N)(=O)=O |
| InChI | InChI=1S/C12H9F3N4O3S/c13-7-2-6(3-8(14)10(7)15)19-12(20)5-1-9(23(17,21)22)11(16)18-4-5/h1-4H,(H2,16,18)(H,19,20)(H2,17,21,22) |
| InChIKey | XWPPHURUYYMVJS-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 128.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.29 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|