C37H37FN4O3S — CID 146301635
[4-[(Z)-1-fluoro-2-[2-methyl-3-[2-methyl-3-[[3-(oxathiazepan-3-ylmethyl)-1,7-naphthyridin-8-yl]amino]phenyl]phenyl]ethenyl]-2-methoxyphenyl]methanol (PubChem CID 146301635) has the molecular formula C37H37FN4O3S and a molecular weight of 636.79 g/mol. Its IUPAC name is [4-[(Z)-1-fluoro-2-[2-methyl-3-[2-methyl-3-[[3-(oxathiazepan-3-ylmethyl)-1,7-naphthyridin-8-yl]amino]phenyl]phenyl]ethenyl]-2-methoxyphenyl]methanol.
| Compound Name | [4-[(Z)-1-fluoro-2-[2-methyl-3-[2-methyl-3-[[3-(oxathiazepan-3-ylmethyl)-1,7-naphthyridin-8-yl]amino]phenyl]phenyl]ethenyl]-2-methoxyphenyl]methanol |
|---|---|
| PubChem CID | 146301635 |
| Molecular Formula | C37H37FN4O3S |
| Molecular Weight | 636.79 g/mol |
| Exact Mass | 636.26 |
| IUPAC Name | [4-[(Z)-1-fluoro-2-[2-methyl-3-[2-methyl-3-[[3-(oxathiazepan-3-ylmethyl)-1,7-naphthyridin-8-yl]amino]phenyl]phenyl]ethenyl]-2-methoxyphenyl]methanol |
| SMILES | COc1cc(/C(F)=C/c2cccc(-c3cccc(Nc4nccc5cc(CN6CCCCOS6)cnc45)c3C)c2C)ccc1CO |
| InChI | InChI=1S/C37H37FN4O3S/c1-24-27(19-33(38)28-12-13-30(23-43)35(20-28)44-3)8-6-9-31(24)32-10-7-11-34(25(32)2)41-37-36-29(14-15-39-37)18-26(21-40-36)22-42-16-4-5-17-45-46-42/h6-15,18-21,43H,4-5,16-17,22-23H2,1-3H3,(H,39,41)/b33-19- |
| InChIKey | VAKJGBWQHXDSBC-APTWKGOFSA-N |
| XLogP | 8.80 |
| TPSA | 79.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.79 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|