About (2R)-2,3-diamino-N-tetradecylpropanamide
(2R)-2,3-diamino-N-tetradecylpropanamide (PubChem CID 146301991) has the molecular formula C17H37N3O
and a molecular weight of 299.50 g/mol. Its IUPAC name is (2R)-2,3-diamino-N-tetradecylpropanamide.
Molecular Properties
| Compound Name | (2R)-2,3-diamino-N-tetradecylpropanamide |
| PubChem CID | 146301991 |
| Molecular Formula | C17H37N3O |
| Molecular Weight | 299.50 g/mol |
| Exact Mass | 299.29 |
| IUPAC Name | (2R)-2,3-diamino-N-tetradecylpropanamide |
| SMILES | CCCCCCCCCCCCCCNC(=O)[C@H](N)CN |
| InChI | InChI=1S/C17H37N3O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-20-17(21)16(19)15-18/h16H,2-15,18-19H2,1H3,(H,20,21)/t16-/m1/s1 |
| InChIKey | VXHFOTRUCBWGKA-MRXNPFEDSA-N |
| XLogP | 3.09 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.50 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2,3-diamino-N-tetradecylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2,3-diamino-N-tetradecylpropanamide?
The IUPAC name of (2R)-2,3-diamino-N-tetradecylpropanamide (CID 146301991) is (2R)-2,3-diamino-N-tetradecylpropanamide.
What is the SMILES notation for (2R)-2,3-diamino-N-tetradecylpropanamide?
The canonical SMILES for (2R)-2,3-diamino-N-tetradecylpropanamide is CCCCCCCCCCCCCCNC(=O)[C@H](N)CN.
What is the InChIKey of (2R)-2,3-diamino-N-tetradecylpropanamide?
The InChIKey is VXHFOTRUCBWGKA-MRXNPFEDSA-N. The full InChI is InChI=1S/C17H37N3O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-20-17(21)16(19)15-18/h16H,2-15,18-19H2,1H3,(H,20,21)/t16-/m1/s1.
What are the key properties of (2R)-2,3-diamino-N-tetradecylpropanamide?
(2R)-2,3-diamino-N-tetradecylpropanamide has a molecular weight of 299.50 g/mol, XLogP of 3.09, 15 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2,3-diamino-N-tetradecylpropanamide is sourced from PubChem (CID 146301991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).