C24H24F2N6O — CID 146302006
2-[4-(7,9-difluoro-1,4,4-trimethyl-5H-[1,2,4]triazolo[4,3-a]quinoxalin-8-yl)indol-1-yl]-N,N-dimethylacetamide (PubChem CID 146302006) has the molecular formula C24H24F2N6O and a molecular weight of 450.49 g/mol. Its IUPAC name is 2-[4-(7,9-difluoro-1,4,4-trimethyl-5H-[1,2,4]triazolo[4,3-a]quinoxalin-8-yl)indol-1-yl]-N,N-dimethylacetamide.
| Compound Name | 2-[4-(7,9-difluoro-1,4,4-trimethyl-5H-[1,2,4]triazolo[4,3-a]quinoxalin-8-yl)indol-1-yl]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 146302006 |
| Molecular Formula | C24H24F2N6O |
| Molecular Weight | 450.49 g/mol |
| Exact Mass | 450.20 |
| IUPAC Name | 2-[4-(7,9-difluoro-1,4,4-trimethyl-5H-[1,2,4]triazolo[4,3-a]quinoxalin-8-yl)indol-1-yl]-N,N-dimethylacetamide |
| SMILES | Cc1nnc2n1-c1c(cc(F)c(-c3cccc4c3ccn4CC(=O)N(C)C)c1F)NC2(C)C |
| InChI | InChI=1S/C24H24F2N6O/c1-13-28-29-23-24(2,3)27-17-11-16(25)20(21(26)22(17)32(13)23)15-7-6-8-18-14(15)9-10-31(18)12-19(33)30(4)5/h6-11,27H,12H2,1-5H3 |
| InChIKey | SGLOAKWZNYILLP-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 67.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.49 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |