C26H27FN6 — CID 146302008
4-[7-(7-fluoro-1,4,4,9-tetramethyl-5H-[1,2,4]triazolo[4,3-a]quinoxalin-8-yl)-1H-indol-3-yl]-2-methylbut-3-yn-2-amine (PubChem CID 146302008) has the molecular formula C26H27FN6 and a molecular weight of 442.54 g/mol. Its IUPAC name is 4-[7-(7-fluoro-1,4,4,9-tetramethyl-5H-[1,2,4]triazolo[4,3-a]quinoxalin-8-yl)-1H-indol-3-yl]-2-methylbut-3-yn-2-amine.
| Compound Name | 4-[7-(7-fluoro-1,4,4,9-tetramethyl-5H-[1,2,4]triazolo[4,3-a]quinoxalin-8-yl)-1H-indol-3-yl]-2-methylbut-3-yn-2-amine |
|---|---|
| PubChem CID | 146302008 |
| Molecular Formula | C26H27FN6 |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.23 |
| IUPAC Name | 4-[7-(7-fluoro-1,4,4,9-tetramethyl-5H-[1,2,4]triazolo[4,3-a]quinoxalin-8-yl)-1H-indol-3-yl]-2-methylbut-3-yn-2-amine |
| SMILES | Cc1c(-c2cccc3c(C#CC(C)(C)N)c[nH]c23)c(F)cc2c1-n1c(C)nnc1C(C)(C)N2 |
| InChI | InChI=1S/C26H27FN6/c1-14-21(18-9-7-8-17-16(13-29-22(17)18)10-11-25(3,4)28)19(27)12-20-23(14)33-15(2)31-32-24(33)26(5,6)30-20/h7-9,12-13,29-30H,28H2,1-6H3 |
| InChIKey | YIYGSTAHTBASCT-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|