C20H16F3N5 — CID 146302083
7,9-difluoro-8-(6-fluoro-1H-indol-4-yl)-1,4,4-trimethyl-5H-[1,2,4]triazolo[4,3-a]quinoxaline (PubChem CID 146302083) has the molecular formula C20H16F3N5 and a molecular weight of 383.40 g/mol. Its IUPAC name is 7,9-difluoro-8-(6-fluoro-1H-indol-4-yl)-1,4,4-trimethyl-5H-[1,2,4]triazolo[4,3-a]quinoxaline.
| Compound Name | 7,9-difluoro-8-(6-fluoro-1H-indol-4-yl)-1,4,4-trimethyl-5H-[1,2,4]triazolo[4,3-a]quinoxaline |
|---|---|
| PubChem CID | 146302083 |
| Molecular Formula | C20H16F3N5 |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | 7,9-difluoro-8-(6-fluoro-1H-indol-4-yl)-1,4,4-trimethyl-5H-[1,2,4]triazolo[4,3-a]quinoxaline |
| SMILES | CC1=NN=C2N1C3=C(C(=C(C=C3NC2(C)C)F)C4=C5C=CNC5=CC(=C4)F)F |
| InChI | InChI=1S/C20H16F3N5/c1-9-26-27-19-20(2,3)25-15-8-13(22)16(17(23)18(15)28(9)19)12-6-10(21)7-14-11(12)4-5-24-14/h4-8,24-25H,1-3H3 |
| InChIKey | WLEJAFLOXYNGFO-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 58.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | 606 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |