C22H17F6N5 — CID 146302106
7,9-difluoro-8-[6-fluoro-1-(2,2,2-trifluoroethyl)indol-4-yl]-1,4,4-trimethyl-5H-[1,2,4]triazolo[4,3-a]quinoxaline (PubChem CID 146302106) has the molecular formula C22H17F6N5 and a molecular weight of 465.40 g/mol. Its IUPAC name is 7,9-difluoro-8-[6-fluoro-1-(2,2,2-trifluoroethyl)indol-4-yl]-1,4,4-trimethyl-5H-[1,2,4]triazolo[4,3-a]quinoxaline.
| Compound Name | 7,9-difluoro-8-[6-fluoro-1-(2,2,2-trifluoroethyl)indol-4-yl]-1,4,4-trimethyl-5H-[1,2,4]triazolo[4,3-a]quinoxaline |
|---|---|
| PubChem CID | 146302106 |
| Molecular Formula | C22H17F6N5 |
| Molecular Weight | 465.40 g/mol |
| Exact Mass | 465.14 |
| IUPAC Name | 7,9-difluoro-8-[6-fluoro-1-(2,2,2-trifluoroethyl)indol-4-yl]-1,4,4-trimethyl-5H-[1,2,4]triazolo[4,3-a]quinoxaline |
| SMILES | Cc1nnc2n1-c1c(cc(F)c(-c3cc(F)cc4c3ccn4CC(F)(F)F)c1F)NC2(C)C |
| InChI | InChI=1S/C22H17F6N5/c1-10-30-31-20-21(2,3)29-15-8-14(24)17(18(25)19(15)33(10)20)13-6-11(23)7-16-12(13)4-5-32(16)9-22(26,27)28/h4-8,29H,9H2,1-3H3 |
| InChIKey | FRQDOCYSQHHNMB-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 47.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.40 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |