C25H27F2N7S — CID 146303230
N-cyano-N'-cyclohexyl-6-[4-fluoro-2-(5-fluoro-2-methylsulfanylphenyl)pyrrolidin-1-yl]imidazo[1,2-b]pyridazine-3-carboximidamide (PubChem CID 146303230) has the molecular formula C25H27F2N7S and a molecular weight of 495.60 g/mol. Its IUPAC name is N-cyano-N'-cyclohexyl-6-[4-fluoro-2-(5-fluoro-2-methylsulfanylphenyl)pyrrolidin-1-yl]imidazo[1,2-b]pyridazine-3-carboximidamide.
| Compound Name | N-cyano-N'-cyclohexyl-6-[4-fluoro-2-(5-fluoro-2-methylsulfanylphenyl)pyrrolidin-1-yl]imidazo[1,2-b]pyridazine-3-carboximidamide |
|---|---|
| PubChem CID | 146303230 |
| Molecular Formula | C25H27F2N7S |
| Molecular Weight | 495.60 g/mol |
| Exact Mass | 495.20 |
| IUPAC Name | N-cyano-N'-cyclohexyl-6-[4-fluoro-2-(5-fluoro-2-methylsulfanylphenyl)pyrrolidin-1-yl]imidazo[1,2-b]pyridazine-3-carboximidamide |
| SMILES | CSc1ccc(F)cc1C1CC(F)CN1c1ccc2ncc(/C(=N/C3CCCCC3)NC#N)n2n1 |
| InChI | InChI=1S/C25H27F2N7S/c1-35-22-8-7-16(26)11-19(22)20-12-17(27)14-33(20)24-10-9-23-29-13-21(34(23)32-24)25(30-15-28)31-18-5-3-2-4-6-18/h7-11,13,17-18,20H,2-6,12,14H2,1H3,(H,30,31) |
| InChIKey | YRRAJJJQDAPXJY-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 81.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.60 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|