C29H37F — CID 146303725
4-[(2Z,4E,6E,8Z)-6,9-diethyl-5-ethynyl-1-fluoroundeca-2,4,6,8,10-pentaen-2-yl]-1-pentylcyclohepta-1,3,5-triene (PubChem CID 146303725) has the molecular formula C29H37F and a molecular weight of 404.61 g/mol. Its IUPAC name is 4-[(2Z,4E,6E,8Z)-6,9-diethyl-5-ethynyl-1-fluoroundeca-2,4,6,8,10-pentaen-2-yl]-1-pentylcyclohepta-1,3,5-triene.
| Compound Name | 4-[(2Z,4E,6E,8Z)-6,9-diethyl-5-ethynyl-1-fluoroundeca-2,4,6,8,10-pentaen-2-yl]-1-pentylcyclohepta-1,3,5-triene |
|---|---|
| PubChem CID | 146303725 |
| Molecular Formula | C29H37F |
| Molecular Weight | 404.61 g/mol |
| Exact Mass | 404.29 |
| IUPAC Name | 4-[(2Z,4E,6E,8Z)-6,9-diethyl-5-ethynyl-1-fluoroundeca-2,4,6,8,10-pentaen-2-yl]-1-pentylcyclohepta-1,3,5-triene |
| SMILES | C#CC(=C\C=C(/CF)C1=CC=C(CCCCC)CC=C1)/C(=C/C=C(\C=C)CC)CC |
| InChI | InChI=1S/C29H37F/c1-6-11-12-14-25-15-13-16-28(20-18-25)29(23-30)22-21-27(10-5)26(9-4)19-17-24(7-2)8-3/h5,7,13,16-22H,2,6,8-9,11-12,14-15,23H2,1,3-4H3/b24-17+,26-19+,27-21+,29-22+ |
| InChIKey | UIZXSCPUYQYTAD-KABGUAMISA-N |
| XLogP | 8.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.61 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|