About methyl-[2-[[5-nitro-4,6-di(propan-2-yl)-2-pyridinyl]oxy]ethyl]carbamic acid
methyl-[2-[[5-nitro-4,6-di(propan-2-yl)-2-pyridinyl]oxy]ethyl]carbamic acid (PubChem CID 146303885) has the molecular formula C15H23N3O5
and a molecular weight of 325.37 g/mol. Its IUPAC name is methyl-[2-[[5-nitro-4,6-di(propan-2-yl)-2-pyridinyl]oxy]ethyl]carbamic acid.
Molecular Properties
| Compound Name | methyl-[2-[[5-nitro-4,6-di(propan-2-yl)-2-pyridinyl]oxy]ethyl]carbamic acid |
| PubChem CID | 146303885 |
| Molecular Formula | C15H23N3O5 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | methyl-[2-[[5-nitro-4,6-di(propan-2-yl)-2-pyridinyl]oxy]ethyl]carbamic acid |
| SMILES | CC(C)c1cc(OCCN(C)C(=O)O)nc(C(C)C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C15H23N3O5/c1-9(2)11-8-12(23-7-6-17(5)15(19)20)16-13(10(3)4)14(11)18(21)22/h8-10H,6-7H2,1-5H3,(H,19,20) |
| InChIKey | SBBZCDVTCFEMFZ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 105.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl-[2-[[5-nitro-4,6-di(propan-2-yl)-2-pyridinyl]oxy]ethyl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl-[2-[[5-nitro-4,6-di(propan-2-yl)-2-pyridinyl]oxy]ethyl]carbamic acid?
The IUPAC name of methyl-[2-[[5-nitro-4,6-di(propan-2-yl)-2-pyridinyl]oxy]ethyl]carbamic acid (CID 146303885) is methyl-[2-[[5-nitro-4,6-di(propan-2-yl)-2-pyridinyl]oxy]ethyl]carbamic acid.
What is the SMILES notation for methyl-[2-[[5-nitro-4,6-di(propan-2-yl)-2-pyridinyl]oxy]ethyl]carbamic acid?
The canonical SMILES for methyl-[2-[[5-nitro-4,6-di(propan-2-yl)-2-pyridinyl]oxy]ethyl]carbamic acid is CC(C)c1cc(OCCN(C)C(=O)O)nc(C(C)C)c1[N+](=O)[O-].
What is the InChIKey of methyl-[2-[[5-nitro-4,6-di(propan-2-yl)-2-pyridinyl]oxy]ethyl]carbamic acid?
The InChIKey is SBBZCDVTCFEMFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23N3O5/c1-9(2)11-8-12(23-7-6-17(5)15(19)20)16-13(10(3)4)14(11)18(21)22/h8-10H,6-7H2,1-5H3,(H,19,20).
What are the key properties of methyl-[2-[[5-nitro-4,6-di(propan-2-yl)-2-pyridinyl]oxy]ethyl]carbamic acid?
methyl-[2-[[5-nitro-4,6-di(propan-2-yl)-2-pyridinyl]oxy]ethyl]carbamic acid has a molecular weight of 325.37 g/mol, XLogP of 3.23, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl-[2-[[5-nitro-4,6-di(propan-2-yl)-2-pyridinyl]oxy]ethyl]carbamic acid is sourced from PubChem (CID 146303885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).