C14H9F3N4O4S — CID 146304082
2-methyl-1,1,3-trioxo-N-(3,4,5-trifluorophenyl)-4H-pyrido[2,3-e][1,2,4]thiadiazine-7-carboxamide (PubChem CID 146304082) has the molecular formula C14H9F3N4O4S and a molecular weight of 386.31 g/mol. Its IUPAC name is 2-methyl-1,1,3-trioxo-N-(3,4,5-trifluorophenyl)-4H-pyrido[2,3-e][1,2,4]thiadiazine-7-carboxamide.
| Compound Name | 2-methyl-1,1,3-trioxo-N-(3,4,5-trifluorophenyl)-4H-pyrido[2,3-e][1,2,4]thiadiazine-7-carboxamide |
|---|---|
| PubChem CID | 146304082 |
| Molecular Formula | C14H9F3N4O4S |
| Molecular Weight | 386.31 g/mol |
| Exact Mass | 386.03 |
| IUPAC Name | 2-methyl-1,1,3-trioxo-N-(3,4,5-trifluorophenyl)-4H-pyrido[2,3-e][1,2,4]thiadiazine-7-carboxamide |
| SMILES | CN1C(=O)Nc2ncc(C(=O)Nc3cc(F)c(F)c(F)c3)cc2S1(=O)=O |
| InChI | InChI=1S/C14H9F3N4O4S/c1-21-14(23)20-12-10(26(21,24)25)2-6(5-18-12)13(22)19-7-3-8(15)11(17)9(16)4-7/h2-5H,1H3,(H,19,22)(H,18,20,23) |
| InChIKey | FVUXWXRWICPMLL-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.31 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|