C10H16F2O3 — CID 146304351
(2E,4Z)-1,5-difluoro-1,2,4-trimethoxyhepta-2,4-diene (PubChem CID 146304351) has the molecular formula C10H16F2O3 and a molecular weight of 222.23 g/mol. Its IUPAC name is (2E,4Z)-1,5-difluoro-1,2,4-trimethoxyhepta-2,4-diene.
| Compound Name | (2E,4Z)-1,5-difluoro-1,2,4-trimethoxyhepta-2,4-diene |
|---|---|
| PubChem CID | 146304351 |
| Molecular Formula | C10H16F2O3 |
| Molecular Weight | 222.23 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | (2E,4Z)-1,5-difluoro-1,2,4-trimethoxyhepta-2,4-diene |
| SMILES | CC/C(F)=C(\C=C(\OC)C(F)OC)OC |
| InChI | InChI=1S/C10H16F2O3/c1-5-7(11)8(13-2)6-9(14-3)10(12)15-4/h6,10H,5H2,1-4H3/b8-7-,9-6+ |
| InChIKey | RGEFEVPKALWAHG-SOKJVCRVSA-N |
| XLogP | 2.70 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.23 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|