C19H17ClN8O — CID 146304876
5-[4-chloro-3-[1-(tetrazol-1-yl)propan-2-yloxy]phenyl]-N-pyridin-2-ylpyrimidin-2-amine (PubChem CID 146304876) has the molecular formula C19H17ClN8O and a molecular weight of 408.85 g/mol. Its IUPAC name is 5-[4-chloro-3-[1-(tetrazol-1-yl)propan-2-yloxy]phenyl]-N-pyridin-2-ylpyrimidin-2-amine.
| Compound Name | 5-[4-chloro-3-[1-(tetrazol-1-yl)propan-2-yloxy]phenyl]-N-pyridin-2-ylpyrimidin-2-amine |
|---|---|
| PubChem CID | 146304876 |
| Molecular Formula | C19H17ClN8O |
| Molecular Weight | 408.85 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | 5-[4-chloro-3-[1-(tetrazol-1-yl)propan-2-yloxy]phenyl]-N-pyridin-2-ylpyrimidin-2-amine |
| SMILES | CC(Cn1cnnn1)Oc1cc(-c2cnc(Nc3ccccn3)nc2)ccc1Cl |
| InChI | InChI=1S/C19H17ClN8O/c1-13(11-28-12-24-26-27-28)29-17-8-14(5-6-16(17)20)15-9-22-19(23-10-15)25-18-4-2-3-7-21-18/h2-10,12-13H,11H2,1H3,(H,21,22,23,25) |
| InChIKey | NEGYJLPDMTUZRS-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 103.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.85 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |