C27H43N3 — CID 146305639
5-N-(4-tert-butylphenyl)-2-N,2-N-dihexylpyridine-2,5-diamine (PubChem CID 146305639) has the molecular formula C27H43N3 and a molecular weight of 409.66 g/mol. Its IUPAC name is 5-N-(4-tert-butylphenyl)-2-N,2-N-dihexylpyridine-2,5-diamine.
| Compound Name | 5-N-(4-tert-butylphenyl)-2-N,2-N-dihexylpyridine-2,5-diamine |
|---|---|
| PubChem CID | 146305639 |
| Molecular Formula | C27H43N3 |
| Molecular Weight | 409.66 g/mol |
| Exact Mass | 409.35 |
| IUPAC Name | 5-N-(4-tert-butylphenyl)-2-N,2-N-dihexylpyridine-2,5-diamine |
| SMILES | CCCCCCN(CCCCCC)c1ccc(Nc2ccc(C(C)(C)C)cc2)cn1 |
| InChI | InChI=1S/C27H43N3/c1-6-8-10-12-20-30(21-13-11-9-7-2)26-19-18-25(22-28-26)29-24-16-14-23(15-17-24)27(3,4)5/h14-19,22,29H,6-13,20-21H2,1-5H3 |
| InChIKey | ZOWDFTJWDSNYNX-UHFFFAOYSA-N |
| XLogP | 8.09 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.66 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|