C29H33ClN6O — CID 146306353
2-[[5-chloro-4-(6-methyl-1H-indol-3-yl)pyrimidin-2-yl]amino]-4-cyclopropyl-6-[[(3S,5R)-3,5-dimethylpiperazin-1-yl]methyl]phenol (PubChem CID 146306353) has the molecular formula C29H33ClN6O and a molecular weight of 517.08 g/mol. Its IUPAC name is 2-[[5-chloro-4-(6-methyl-1H-indol-3-yl)pyrimidin-2-yl]amino]-4-cyclopropyl-6-[[(3S,5R)-3,5-dimethylpiperazin-1-yl]methyl]phenol.
| Compound Name | 2-[[5-chloro-4-(6-methyl-1H-indol-3-yl)pyrimidin-2-yl]amino]-4-cyclopropyl-6-[[(3S,5R)-3,5-dimethylpiperazin-1-yl]methyl]phenol |
|---|---|
| PubChem CID | 146306353 |
| Molecular Formula | C29H33ClN6O |
| Molecular Weight | 517.08 g/mol |
| Exact Mass | 516.24 |
| IUPAC Name | 2-[[5-chloro-4-(6-methyl-1H-indol-3-yl)pyrimidin-2-yl]amino]-4-cyclopropyl-6-[[(3S,5R)-3,5-dimethylpiperazin-1-yl]methyl]phenol |
| SMILES | Cc1ccc2c(-c3nc(Nc4cc(C5CC5)cc(CN5C[C@@H](C)N[C@@H](C)C5)c4O)ncc3Cl)c[nH]c2c1 |
| InChI | InChI=1S/C29H33ClN6O/c1-16-4-7-22-23(11-31-25(22)8-16)27-24(30)12-32-29(35-27)34-26-10-20(19-5-6-19)9-21(28(26)37)15-36-13-17(2)33-18(3)14-36/h4,7-12,17-19,31,33,37H,5-6,13-15H2,1-3H3,(H,32,34,35)/t17-,18+ |
| InChIKey | MNPVYGOUSLAGOL-HDICACEKSA-N |
| XLogP | 6.10 |
| TPSA | 89.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.08 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|