C24H28FN7O — CID 146306602
4-(3-fluorophenyl)-N-[(1R,5S)-3-(2-methoxy-4-pyridinyl)-3-azabicyclo[3.2.1]octan-8-yl]-6,7-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine (PubChem CID 146306602) has the molecular formula C24H28FN7O and a molecular weight of 449.53 g/mol. Its IUPAC name is 4-(3-fluorophenyl)-N-[(1R,5S)-3-(2-methoxy-4-pyridinyl)-3-azabicyclo[3.2.1]octan-8-yl]-6,7-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine.
| Compound Name | 4-(3-fluorophenyl)-N-[(1R,5S)-3-(2-methoxy-4-pyridinyl)-3-azabicyclo[3.2.1]octan-8-yl]-6,7-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine |
|---|---|
| PubChem CID | 146306602 |
| Molecular Formula | C24H28FN7O |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.23 |
| IUPAC Name | 4-(3-fluorophenyl)-N-[(1R,5S)-3-(2-methoxy-4-pyridinyl)-3-azabicyclo[3.2.1]octan-8-yl]-6,7-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine |
| SMILES | COc1cc(N2C[C@H]3CC[C@@H](C2)C3Nc2nc3n(n2)CCCN3c2cccc(F)c2)ccn1 |
| InChI | InChI=1S/C24H28FN7O/c1-33-21-13-19(8-9-26-21)30-14-16-6-7-17(15-30)22(16)27-23-28-24-31(10-3-11-32(24)29-23)20-5-2-4-18(25)12-20/h2,4-5,8-9,12-13,16-17,22H,3,6-7,10-11,14-15H2,1H3,(H,27,29)/t16-,17+,22? |
| InChIKey | CYQUZTVMTBZINH-AQKKSAQBSA-N |
| XLogP | 3.69 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |