About 1-[(4-hydroxyphenyl)methyl]-4-methoxyphenanthrene-2,7-diol
1-[(4-hydroxyphenyl)methyl]-4-methoxyphenanthrene-2,7-diol (PubChem CID 14630664) has the molecular formula C22H18O4
and a molecular weight of 346.38 g/mol. Its IUPAC name is 1-[(4-hydroxyphenyl)methyl]-4-methoxyphenanthrene-2,7-diol.
Molecular Properties
| Compound Name | 1-[(4-hydroxyphenyl)methyl]-4-methoxyphenanthrene-2,7-diol |
| PubChem CID | 14630664 |
| Molecular Formula | C22H18O4 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | 1-[(4-hydroxyphenyl)methyl]-4-methoxyphenanthrene-2,7-diol |
| SMILES | COc1cc(O)c(Cc2ccc(O)cc2)c2ccc3cc(O)ccc3c12 |
| InChI | InChI=1S/C22H18O4/c1-26-21-12-20(25)19(10-13-2-5-15(23)6-3-13)18-8-4-14-11-16(24)7-9-17(14)22(18)21/h2-9,11-12,23-25H,10H2,1H3 |
| InChIKey | XCJSWJPRPDMYLS-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 1-[(4-hydroxyphenyl)methyl]-4-methoxyphenanthrene-2,7-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4-hydroxyphenyl)methyl]-4-methoxyphenanthrene-2,7-diol?
The IUPAC name of 1-[(4-hydroxyphenyl)methyl]-4-methoxyphenanthrene-2,7-diol (CID 14630664) is 1-[(4-hydroxyphenyl)methyl]-4-methoxyphenanthrene-2,7-diol.
What is the SMILES notation for 1-[(4-hydroxyphenyl)methyl]-4-methoxyphenanthrene-2,7-diol?
The canonical SMILES for 1-[(4-hydroxyphenyl)methyl]-4-methoxyphenanthrene-2,7-diol is COc1cc(O)c(Cc2ccc(O)cc2)c2ccc3cc(O)ccc3c12.
What is the InChIKey of 1-[(4-hydroxyphenyl)methyl]-4-methoxyphenanthrene-2,7-diol?
The InChIKey is XCJSWJPRPDMYLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H18O4/c1-26-21-12-20(25)19(10-13-2-5-15(23)6-3-13)18-8-4-14-11-16(24)7-9-17(14)22(18)21/h2-9,11-12,23-25H,10H2,1H3.
What are the key properties of 1-[(4-hydroxyphenyl)methyl]-4-methoxyphenanthrene-2,7-diol?
1-[(4-hydroxyphenyl)methyl]-4-methoxyphenanthrene-2,7-diol has a molecular weight of 346.38 g/mol, XLogP of 4.71, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4-hydroxyphenyl)methyl]-4-methoxyphenanthrene-2,7-diol is sourced from PubChem (CID 14630664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).