C24H27F2N7O — CID 146306646
4-(3,4-difluorophenyl)-N-[(1R,5S)-3-(2-methoxy-4-pyridinyl)-3-azabicyclo[3.2.1]octan-8-yl]-6,7-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine (PubChem CID 146306646) has the molecular formula C24H27F2N7O and a molecular weight of 467.52 g/mol. Its IUPAC name is 4-(3,4-difluorophenyl)-N-[(1R,5S)-3-(2-methoxy-4-pyridinyl)-3-azabicyclo[3.2.1]octan-8-yl]-6,7-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine.
| Compound Name | 4-(3,4-difluorophenyl)-N-[(1R,5S)-3-(2-methoxy-4-pyridinyl)-3-azabicyclo[3.2.1]octan-8-yl]-6,7-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine |
|---|---|
| PubChem CID | 146306646 |
| Molecular Formula | C24H27F2N7O |
| Molecular Weight | 467.52 g/mol |
| Exact Mass | 467.22 |
| IUPAC Name | 4-(3,4-difluorophenyl)-N-[(1R,5S)-3-(2-methoxy-4-pyridinyl)-3-azabicyclo[3.2.1]octan-8-yl]-6,7-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine |
| SMILES | COc1cc(N2C[C@H]3CC[C@@H](C2)C3Nc2nc3n(n2)CCCN3c2ccc(F)c(F)c2)ccn1 |
| InChI | InChI=1S/C24H27F2N7O/c1-34-21-12-17(7-8-27-21)31-13-15-3-4-16(14-31)22(15)28-23-29-24-32(9-2-10-33(24)30-23)18-5-6-19(25)20(26)11-18/h5-8,11-12,15-16,22H,2-4,9-10,13-14H2,1H3,(H,28,30)/t15-,16+,22? |
| InChIKey | PDOHVGKIOMMAAD-XVQYUUQNSA-N |
| XLogP | 3.83 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.52 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |