About 2-azabicyclo[3.1.0]hexa-1,3,5-triene;methanol
2-azabicyclo[3.1.0]hexa-1,3,5-triene;methanol (PubChem CID 146306786) has the molecular formula C6H7NO
and a molecular weight of 109.13 g/mol. Its IUPAC name is 2-azabicyclo[3.1.0]hexa-1,3,5-triene;methanol.
Molecular Properties
| Compound Name | 2-azabicyclo[3.1.0]hexa-1,3,5-triene;methanol |
| PubChem CID | 146306786 |
| Molecular Formula | C6H7NO |
| Molecular Weight | 109.13 g/mol |
| Exact Mass | 109.05 |
| IUPAC Name | 2-azabicyclo[3.1.0]hexa-1,3,5-triene;methanol |
| SMILES | CO.c1cc2cc-2n1 |
| InChI | InChI=1S/C5H3N.CH4O/c1-2-6-5-3-4(1)5;1-2/h1-3H;2H,1H3 |
| InChIKey | VVOVMSFXESJXEZ-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 109.13 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-azabicyclo[3.1.0]hexa-1,3,5-triene;methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-azabicyclo[3.1.0]hexa-1,3,5-triene;methanol?
The IUPAC name of 2-azabicyclo[3.1.0]hexa-1,3,5-triene;methanol (CID 146306786) is 2-azabicyclo[3.1.0]hexa-1,3,5-triene;methanol.
What is the SMILES notation for 2-azabicyclo[3.1.0]hexa-1,3,5-triene;methanol?
The canonical SMILES for 2-azabicyclo[3.1.0]hexa-1,3,5-triene;methanol is CO.c1cc2cc-2n1.
What is the InChIKey of 2-azabicyclo[3.1.0]hexa-1,3,5-triene;methanol?
The InChIKey is VVOVMSFXESJXEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H3N.CH4O/c1-2-6-5-3-4(1)5;1-2/h1-3H;2H,1H3.
What are the key properties of 2-azabicyclo[3.1.0]hexa-1,3,5-triene;methanol?
2-azabicyclo[3.1.0]hexa-1,3,5-triene;methanol has a molecular weight of 109.13 g/mol, XLogP of 0.67, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-azabicyclo[3.1.0]hexa-1,3,5-triene;methanol is sourced from PubChem (CID 146306786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).