C26H18F3N7O — CID 146307143
3-[8-amino-2-[(2,6-difluorophenyl)-hydroxymethyl]-5-(2,6-dimethyl-4-pyridinyl)-[1,2,4]triazolo[1,5-a]pyrazin-6-yl]-2-fluorobenzonitrile (PubChem CID 146307143) has the molecular formula C26H18F3N7O and a molecular weight of 501.47 g/mol. Its IUPAC name is 3-[8-amino-2-[(2,6-difluorophenyl)-hydroxymethyl]-5-(2,6-dimethyl-4-pyridinyl)-[1,2,4]triazolo[1,5-a]pyrazin-6-yl]-2-fluorobenzonitrile.
| Compound Name | 3-[8-amino-2-[(2,6-difluorophenyl)-hydroxymethyl]-5-(2,6-dimethyl-4-pyridinyl)-[1,2,4]triazolo[1,5-a]pyrazin-6-yl]-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 146307143 |
| Molecular Formula | C26H18F3N7O |
| Molecular Weight | 501.47 g/mol |
| Exact Mass | 501.15 |
| IUPAC Name | 3-[8-amino-2-[(2,6-difluorophenyl)-hydroxymethyl]-5-(2,6-dimethyl-4-pyridinyl)-[1,2,4]triazolo[1,5-a]pyrazin-6-yl]-2-fluorobenzonitrile |
| SMILES | Cc1cc(-c2c(-c3cccc(C#N)c3F)nc(N)c3nc(C(O)c4c(F)cccc4F)nn23)cc(C)n1 |
| InChI | InChI=1S/C26H18F3N7O/c1-12-9-15(10-13(2)32-12)22-21(16-6-3-5-14(11-30)20(16)29)33-24(31)26-34-25(35-36(22)26)23(37)19-17(27)7-4-8-18(19)28/h3-10,23,37H,1-2H3,(H2,31,33) |
| InChIKey | DWTCDOBGKRPOFB-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 126.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.47 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |