C27H37N2O6P — CID 14630739
(2S,4R)-1-[(2S)-6-amino-2-[hydroxy(4-phenylbutyl)phosphoryl]oxyhexanoyl]-4-phenylpyrrolidine-2-carboxylic acid (PubChem CID 14630739) has the molecular formula C27H37N2O6P and a molecular weight of 516.58 g/mol. Its IUPAC name is (2S,4R)-1-[(2S)-6-amino-2-[hydroxy(4-phenylbutyl)phosphoryl]oxyhexanoyl]-4-phenylpyrrolidine-2-carboxylic acid.
| Compound Name | (2S,4R)-1-[(2S)-6-amino-2-[hydroxy(4-phenylbutyl)phosphoryl]oxyhexanoyl]-4-phenylpyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 14630739 |
| Molecular Formula | C27H37N2O6P |
| Molecular Weight | 516.58 g/mol |
| Exact Mass | 516.24 |
| IUPAC Name | (2S,4R)-1-[(2S)-6-amino-2-[hydroxy(4-phenylbutyl)phosphoryl]oxyhexanoyl]-4-phenylpyrrolidine-2-carboxylic acid |
| SMILES | NCCCC[C@H](OP(=O)(O)CCCCc1ccccc1)C(=O)N1C[C@@H](c2ccccc2)C[C@H]1C(=O)O |
| InChI | InChI=1S/C27H37N2O6P/c28-17-9-7-16-25(35-36(33,34)18-10-8-13-21-11-3-1-4-12-21)26(30)29-20-23(19-24(29)27(31)32)22-14-5-2-6-15-22/h1-6,11-12,14-15,23-25H,7-10,13,16-20,28H2,(H,31,32)(H,33,34)/t23-,24-,25-/m0/s1 |
| InChIKey | UFLPIELGAQYNCT-SDHOMARFSA-N |
| XLogP | 4.18 |
| TPSA | 130.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.58 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|