C27H37N2O6PS — CID 14630749
(2S,4R)-1-[(2S)-6-amino-2-[hydroxy(4-phenylbutyl)phosphoryl]oxyhexanoyl]-4-phenylsulfanylpyrrolidine-2-carboxylic acid (PubChem CID 14630749) has the molecular formula C27H37N2O6PS and a molecular weight of 548.64 g/mol. Its IUPAC name is (2S,4R)-1-[(2S)-6-amino-2-[hydroxy(4-phenylbutyl)phosphoryl]oxyhexanoyl]-4-phenylsulfanylpyrrolidine-2-carboxylic acid.
| Compound Name | (2S,4R)-1-[(2S)-6-amino-2-[hydroxy(4-phenylbutyl)phosphoryl]oxyhexanoyl]-4-phenylsulfanylpyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 14630749 |
| Molecular Formula | C27H37N2O6PS |
| Molecular Weight | 548.64 g/mol |
| Exact Mass | 548.21 |
| IUPAC Name | (2S,4R)-1-[(2S)-6-amino-2-[hydroxy(4-phenylbutyl)phosphoryl]oxyhexanoyl]-4-phenylsulfanylpyrrolidine-2-carboxylic acid |
| SMILES | NCCCC[C@H](OP(=O)(O)CCCCc1ccccc1)C(=O)N1C[C@H](Sc2ccccc2)C[C@H]1C(=O)O |
| InChI | InChI=1S/C27H37N2O6PS/c28-17-9-7-16-25(35-36(33,34)18-10-8-13-21-11-3-1-4-12-21)26(30)29-20-23(19-24(29)27(31)32)37-22-14-5-2-6-15-22/h1-6,11-12,14-15,23-25H,7-10,13,16-20,28H2,(H,31,32)(H,33,34)/t23-,24+,25+/m1/s1 |
| InChIKey | OBISBDQBCPFOOQ-DSITVLBTSA-N |
| XLogP | 4.56 |
| TPSA | 130.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.64 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|