C22H35N2O6PS — CID 14630755
(2S,4R)-1-[(2S)-6-amino-2-[hydroxy(4-phenylbutyl)phosphoryl]oxyhexanoyl]-4-methylsulfanylpyrrolidine-2-carboxylic acid (PubChem CID 14630755) has the molecular formula C22H35N2O6PS and a molecular weight of 486.57 g/mol. Its IUPAC name is (2S,4R)-1-[(2S)-6-amino-2-[hydroxy(4-phenylbutyl)phosphoryl]oxyhexanoyl]-4-methylsulfanylpyrrolidine-2-carboxylic acid.
| Compound Name | (2S,4R)-1-[(2S)-6-amino-2-[hydroxy(4-phenylbutyl)phosphoryl]oxyhexanoyl]-4-methylsulfanylpyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 14630755 |
| Molecular Formula | C22H35N2O6PS |
| Molecular Weight | 486.57 g/mol |
| Exact Mass | 486.20 |
| IUPAC Name | (2S,4R)-1-[(2S)-6-amino-2-[hydroxy(4-phenylbutyl)phosphoryl]oxyhexanoyl]-4-methylsulfanylpyrrolidine-2-carboxylic acid |
| SMILES | CS[C@@H]1C[C@@H](C(=O)O)N(C(=O)[C@H](CCCCN)OP(=O)(O)CCCCc2ccccc2)C1 |
| InChI | InChI=1S/C22H35N2O6PS/c1-32-18-15-19(22(26)27)24(16-18)21(25)20(12-5-7-13-23)30-31(28,29)14-8-6-11-17-9-3-2-4-10-17/h2-4,9-10,18-20H,5-8,11-16,23H2,1H3,(H,26,27)(H,28,29)/t18-,19+,20+/m1/s1 |
| InChIKey | CFYJLONIQYEPQR-AABGKKOBSA-N |
| XLogP | 3.13 |
| TPSA | 130.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.57 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|