C23H35N2O6PS2 — CID 14630765
(8S)-7-[(2S)-6-amino-2-[hydroxy(4-phenylbutyl)phosphoryl]oxyhexanoyl]-1,4-dithia-7-azaspiro[4.4]nonane-8-carboxylic acid (PubChem CID 14630765) has the molecular formula C23H35N2O6PS2 and a molecular weight of 530.65 g/mol. Its IUPAC name is (8S)-7-[(2S)-6-amino-2-[hydroxy(4-phenylbutyl)phosphoryl]oxyhexanoyl]-1,4-dithia-7-azaspiro[4.4]nonane-8-carboxylic acid.
| Compound Name | (8S)-7-[(2S)-6-amino-2-[hydroxy(4-phenylbutyl)phosphoryl]oxyhexanoyl]-1,4-dithia-7-azaspiro[4.4]nonane-8-carboxylic acid |
|---|---|
| PubChem CID | 14630765 |
| Molecular Formula | C23H35N2O6PS2 |
| Molecular Weight | 530.65 g/mol |
| Exact Mass | 530.17 |
| IUPAC Name | (8S)-7-[(2S)-6-amino-2-[hydroxy(4-phenylbutyl)phosphoryl]oxyhexanoyl]-1,4-dithia-7-azaspiro[4.4]nonane-8-carboxylic acid |
| SMILES | NCCCC[C@H](OP(=O)(O)CCCCc1ccccc1)C(=O)N1CC2(C[C@H]1C(=O)O)SCCS2 |
| InChI | InChI=1S/C23H35N2O6PS2/c24-12-6-4-11-20(31-32(29,30)13-7-5-10-18-8-2-1-3-9-18)21(26)25-17-23(33-14-15-34-23)16-19(25)22(27)28/h1-3,8-9,19-20H,4-7,10-17,24H2,(H,27,28)(H,29,30)/t19-,20-/m0/s1 |
| InChIKey | IXBHIQKODCOORP-PMACEKPBSA-N |
| XLogP | 3.57 |
| TPSA | 130.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.65 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|