C21H33N2O7P — CID 14630769
(2S,4R)-1-[(2S)-6-amino-2-[hydroxy(4-phenylbutyl)phosphoryl]oxyhexanoyl]-4-hydroxypyrrolidine-2-carboxylic acid (PubChem CID 14630769) has the molecular formula C21H33N2O7P and a molecular weight of 456.48 g/mol. Its IUPAC name is (2S,4R)-1-[(2S)-6-amino-2-[hydroxy(4-phenylbutyl)phosphoryl]oxyhexanoyl]-4-hydroxypyrrolidine-2-carboxylic acid.
| Compound Name | (2S,4R)-1-[(2S)-6-amino-2-[hydroxy(4-phenylbutyl)phosphoryl]oxyhexanoyl]-4-hydroxypyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 14630769 |
| Molecular Formula | C21H33N2O7P |
| Molecular Weight | 456.48 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | (2S,4R)-1-[(2S)-6-amino-2-[hydroxy(4-phenylbutyl)phosphoryl]oxyhexanoyl]-4-hydroxypyrrolidine-2-carboxylic acid |
| SMILES | NCCCC[C@H](OP(=O)(O)CCCCc1ccccc1)C(=O)N1C[C@H](O)C[C@H]1C(=O)O |
| InChI | InChI=1S/C21H33N2O7P/c22-12-6-4-11-19(20(25)23-15-17(24)14-18(23)21(26)27)30-31(28,29)13-7-5-10-16-8-2-1-3-9-16/h1-3,8-9,17-19,24H,4-7,10-15,22H2,(H,26,27)(H,28,29)/t17-,18+,19+/m1/s1 |
| InChIKey | INKBVRKDEQLILX-QYZOEREBSA-N |
| XLogP | 1.76 |
| TPSA | 150.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.48 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|