About 5-bromo-3,4-dichloro-2-(fluoromethyl)indazole
5-bromo-3,4-dichloro-2-(fluoromethyl)indazole (PubChem CID 146308000) has the molecular formula C8H4BrCl2FN2
and a molecular weight of 297.94 g/mol. Its IUPAC name is 5-bromo-3,4-dichloro-2-(fluoromethyl)indazole.
Molecular Properties
| Compound Name | 5-bromo-3,4-dichloro-2-(fluoromethyl)indazole |
| PubChem CID | 146308000 |
| Molecular Formula | C8H4BrCl2FN2 |
| Molecular Weight | 297.94 g/mol |
| Exact Mass | 295.89 |
| IUPAC Name | 5-bromo-3,4-dichloro-2-(fluoromethyl)indazole |
| SMILES | FCn1nc2ccc(Br)c(Cl)c2c1Cl |
| InChI | InChI=1S/C8H4BrCl2FN2/c9-4-1-2-5-6(7(4)10)8(11)14(3-12)13-5/h1-2H,3H2 |
| InChIKey | UKECFHNNVJCVKI-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.94 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-bromo-3,4-dichloro-2-(fluoromethyl)indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-3,4-dichloro-2-(fluoromethyl)indazole?
The IUPAC name of 5-bromo-3,4-dichloro-2-(fluoromethyl)indazole (CID 146308000) is 5-bromo-3,4-dichloro-2-(fluoromethyl)indazole.
What is the SMILES notation for 5-bromo-3,4-dichloro-2-(fluoromethyl)indazole?
The canonical SMILES for 5-bromo-3,4-dichloro-2-(fluoromethyl)indazole is FCn1nc2ccc(Br)c(Cl)c2c1Cl.
What is the InChIKey of 5-bromo-3,4-dichloro-2-(fluoromethyl)indazole?
The InChIKey is UKECFHNNVJCVKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4BrCl2FN2/c9-4-1-2-5-6(7(4)10)8(11)14(3-12)13-5/h1-2H,3H2.
What are the key properties of 5-bromo-3,4-dichloro-2-(fluoromethyl)indazole?
5-bromo-3,4-dichloro-2-(fluoromethyl)indazole has a molecular weight of 297.94 g/mol, XLogP of 4.03, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-3,4-dichloro-2-(fluoromethyl)indazole is sourced from PubChem (CID 146308000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).