C21H31N2O6P — CID 14630805
(2S)-1-[(2S)-6-amino-2-[hydroxy(4-phenylbutyl)phosphoryl]oxyhexanoyl]-2,5-dihydropyrrole-2-carboxylic acid (PubChem CID 14630805) has the molecular formula C21H31N2O6P and a molecular weight of 438.46 g/mol. Its IUPAC name is (2S)-1-[(2S)-6-amino-2-[hydroxy(4-phenylbutyl)phosphoryl]oxyhexanoyl]-2,5-dihydropyrrole-2-carboxylic acid.
| Compound Name | (2S)-1-[(2S)-6-amino-2-[hydroxy(4-phenylbutyl)phosphoryl]oxyhexanoyl]-2,5-dihydropyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 14630805 |
| Molecular Formula | C21H31N2O6P |
| Molecular Weight | 438.46 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | (2S)-1-[(2S)-6-amino-2-[hydroxy(4-phenylbutyl)phosphoryl]oxyhexanoyl]-2,5-dihydropyrrole-2-carboxylic acid |
| SMILES | NCCCC[C@H](OP(=O)(O)CCCCc1ccccc1)C(=O)N1CC=C[C@H]1C(=O)O |
| InChI | InChI=1S/C21H31N2O6P/c22-14-6-4-13-19(20(24)23-15-8-12-18(23)21(25)26)29-30(27,28)16-7-5-11-17-9-2-1-3-10-17/h1-3,8-10,12,18-19H,4-7,11,13-16,22H2,(H,25,26)(H,27,28)/t18-,19-/m0/s1 |
| InChIKey | HQSAMEZTFOFYND-OALUTQOASA-N |
| XLogP | 2.56 |
| TPSA | 130.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.46 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|