C30H37N3O3 — CID 146308622
[3-[2-[(1-benzylpiperidin-4-yl)methylamino]phenoxy]-3-phenylpropyl]-methylcarbamic acid (PubChem CID 146308622) has the molecular formula C30H37N3O3 and a molecular weight of 487.64 g/mol. Its IUPAC name is [3-[2-[(1-benzylpiperidin-4-yl)methylamino]phenoxy]-3-phenylpropyl]-methylcarbamic acid.
| Compound Name | [3-[2-[(1-benzylpiperidin-4-yl)methylamino]phenoxy]-3-phenylpropyl]-methylcarbamic acid |
|---|---|
| PubChem CID | 146308622 |
| Molecular Formula | C30H37N3O3 |
| Molecular Weight | 487.64 g/mol |
| Exact Mass | 487.28 |
| IUPAC Name | [3-[2-[(1-benzylpiperidin-4-yl)methylamino]phenoxy]-3-phenylpropyl]-methylcarbamic acid |
| SMILES | CN(CCC(Oc1ccccc1NCC1CCN(Cc2ccccc2)CC1)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C30H37N3O3/c1-32(30(34)35)19-18-28(26-12-6-3-7-13-26)36-29-15-9-8-14-27(29)31-22-24-16-20-33(21-17-24)23-25-10-4-2-5-11-25/h2-15,24,28,31H,16-23H2,1H3,(H,34,35) |
| InChIKey | TUVMJEJBOZCXAW-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 65.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.64 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |