C16H31NO3 — CID 146309669
[2-hydroxy-3-(2-methylaziridin-1-yl)propyl] 7,7-dimethyloctanoate (PubChem CID 146309669) has the molecular formula C16H31NO3 and a molecular weight of 285.43 g/mol. Its IUPAC name is [2-hydroxy-3-(2-methylaziridin-1-yl)propyl] 7,7-dimethyloctanoate.
| Compound Name | [2-hydroxy-3-(2-methylaziridin-1-yl)propyl] 7,7-dimethyloctanoate |
|---|---|
| PubChem CID | 146309669 |
| Molecular Formula | C16H31NO3 |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.23 |
| IUPAC Name | [2-hydroxy-3-(2-methylaziridin-1-yl)propyl] 7,7-dimethyloctanoate |
| SMILES | CC1CN1CC(O)COC(=O)CCCCCC(C)(C)C |
| InChI | InChI=1S/C16H31NO3/c1-13-10-17(13)11-14(18)12-20-15(19)8-6-5-7-9-16(2,3)4/h13-14,18H,5-12H2,1-4H3 |
| InChIKey | CWPULMSCHUSGOL-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 49.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|