C15H18F3N2O7S+ — CID 146310896
[4-(3-carbamoylpyridin-1-ium-1-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl trifluoromethanesulfonate (PubChem CID 146310896) has the molecular formula C15H18F3N2O7S+ and a molecular weight of 427.38 g/mol. Its IUPAC name is [4-(3-carbamoylpyridin-1-ium-1-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl trifluoromethanesulfonate.
| Compound Name | [4-(3-carbamoylpyridin-1-ium-1-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl trifluoromethanesulfonate |
|---|---|
| PubChem CID | 146310896 |
| Molecular Formula | C15H18F3N2O7S+ |
| Molecular Weight | 427.38 g/mol |
| Exact Mass | 427.08 |
| IUPAC Name | [4-(3-carbamoylpyridin-1-ium-1-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl trifluoromethanesulfonate |
| SMILES | CC1(C)OC2C(COS(=O)(=O)C(F)(F)F)OC([n+]3cccc(C(N)=O)c3)C2O1 |
| InChI | InChI=1S/C15H17F3N2O7S/c1-14(2)26-10-9(7-24-28(22,23)15(16,17)18)25-13(11(10)27-14)20-5-3-4-8(6-20)12(19)21/h3-6,9-11,13H,7H2,1-2H3,(H-,19,21)/p+1 |
| InChIKey | RBKXLHSSLXDXPL-UHFFFAOYSA-O |
| XLogP | 0.36 |
| TPSA | 118.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.38 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|