C25H29N5O — CID 146311607
8-[1-(2-methoxyethyl)indol-4-yl]-1,4,4,7,9-pentamethyl-5H-[1,2,4]triazolo[4,3-a]quinoxaline (PubChem CID 146311607) has the molecular formula C25H29N5O and a molecular weight of 415.54 g/mol. Its IUPAC name is 8-[1-(2-methoxyethyl)indol-4-yl]-1,4,4,7,9-pentamethyl-5H-[1,2,4]triazolo[4,3-a]quinoxaline.
| Compound Name | 8-[1-(2-methoxyethyl)indol-4-yl]-1,4,4,7,9-pentamethyl-5H-[1,2,4]triazolo[4,3-a]quinoxaline |
|---|---|
| PubChem CID | 146311607 |
| Molecular Formula | C25H29N5O |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.24 |
| IUPAC Name | 8-[1-(2-methoxyethyl)indol-4-yl]-1,4,4,7,9-pentamethyl-5H-[1,2,4]triazolo[4,3-a]quinoxaline |
| SMILES | COCCn1ccc2c(-c3c(C)cc4c(c3C)-n3c(C)nnc3C(C)(C)N4)cccc21 |
| InChI | InChI=1S/C25H29N5O/c1-15-14-20-23(30-17(3)27-28-24(30)25(4,5)26-20)16(2)22(15)19-8-7-9-21-18(19)10-11-29(21)12-13-31-6/h7-11,14,26H,12-13H2,1-6H3 |
| InChIKey | JKXKYFPWCNZIPK-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 56.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |