About 3-tert-butyl-6H-triazolo[4,5-d]pyrimidin-7-one
3-tert-butyl-6H-triazolo[4,5-d]pyrimidin-7-one (PubChem CID 146312179) has the molecular formula C8H11N5O
and a molecular weight of 193.21 g/mol. Its IUPAC name is 3-tert-butyl-6H-triazolo[4,5-d]pyrimidin-7-one.
Molecular Properties
| Compound Name | 3-tert-butyl-6H-triazolo[4,5-d]pyrimidin-7-one |
| PubChem CID | 146312179 |
| Molecular Formula | C8H11N5O |
| Molecular Weight | 193.21 g/mol |
| Exact Mass | 193.10 |
| IUPAC Name | 3-tert-butyl-6H-triazolo[4,5-d]pyrimidin-7-one |
| SMILES | CC(C)(C)n1nnc2c(=O)[nH]cnc21 |
| InChI | InChI=1S/C8H11N5O/c1-8(2,3)13-6-5(11-12-13)7(14)10-4-9-6/h4H,1-3H3,(H,9,10,14) |
| InChIKey | MMXJMPGKRFXGTE-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.21 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-tert-butyl-6H-triazolo[4,5-d]pyrimidin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tert-butyl-6H-triazolo[4,5-d]pyrimidin-7-one?
The IUPAC name of 3-tert-butyl-6H-triazolo[4,5-d]pyrimidin-7-one (CID 146312179) is 3-tert-butyl-6H-triazolo[4,5-d]pyrimidin-7-one.
What is the SMILES notation for 3-tert-butyl-6H-triazolo[4,5-d]pyrimidin-7-one?
The canonical SMILES for 3-tert-butyl-6H-triazolo[4,5-d]pyrimidin-7-one is CC(C)(C)n1nnc2c(=O)[nH]cnc21.
What is the InChIKey of 3-tert-butyl-6H-triazolo[4,5-d]pyrimidin-7-one?
The InChIKey is MMXJMPGKRFXGTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N5O/c1-8(2,3)13-6-5(11-12-13)7(14)10-4-9-6/h4H,1-3H3,(H,9,10,14).
What are the key properties of 3-tert-butyl-6H-triazolo[4,5-d]pyrimidin-7-one?
3-tert-butyl-6H-triazolo[4,5-d]pyrimidin-7-one has a molecular weight of 193.21 g/mol, XLogP of 0.27, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tert-butyl-6H-triazolo[4,5-d]pyrimidin-7-one is sourced from PubChem (CID 146312179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).