About 6-methyl-3-nitro-2,4-di(propan-2-yl)pyridine
6-methyl-3-nitro-2,4-di(propan-2-yl)pyridine (PubChem CID 146312275) has the molecular formula C12H18N2O2
and a molecular weight of 222.29 g/mol. Its IUPAC name is 6-methyl-3-nitro-2,4-di(propan-2-yl)pyridine.
Molecular Properties
| Compound Name | 6-methyl-3-nitro-2,4-di(propan-2-yl)pyridine |
| PubChem CID | 146312275 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 6-methyl-3-nitro-2,4-di(propan-2-yl)pyridine |
| SMILES | Cc1cc(C(C)C)c([N+](=O)[O-])c(C(C)C)n1 |
| InChI | InChI=1S/C12H18N2O2/c1-7(2)10-6-9(5)13-11(8(3)4)12(10)14(15)16/h6-8H,1-5H3 |
| InChIKey | YPOVKJHULNTTTL-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 56.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-methyl-3-nitro-2,4-di(propan-2-yl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-3-nitro-2,4-di(propan-2-yl)pyridine?
The IUPAC name of 6-methyl-3-nitro-2,4-di(propan-2-yl)pyridine (CID 146312275) is 6-methyl-3-nitro-2,4-di(propan-2-yl)pyridine.
What is the SMILES notation for 6-methyl-3-nitro-2,4-di(propan-2-yl)pyridine?
The canonical SMILES for 6-methyl-3-nitro-2,4-di(propan-2-yl)pyridine is Cc1cc(C(C)C)c([N+](=O)[O-])c(C(C)C)n1.
What is the InChIKey of 6-methyl-3-nitro-2,4-di(propan-2-yl)pyridine?
The InChIKey is YPOVKJHULNTTTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2O2/c1-7(2)10-6-9(5)13-11(8(3)4)12(10)14(15)16/h6-8H,1-5H3.
What are the key properties of 6-methyl-3-nitro-2,4-di(propan-2-yl)pyridine?
6-methyl-3-nitro-2,4-di(propan-2-yl)pyridine has a molecular weight of 222.29 g/mol, XLogP of 3.55, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-3-nitro-2,4-di(propan-2-yl)pyridine is sourced from PubChem (CID 146312275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).