C34H45N5O5S — CID 146312624
3-[3-[[7-(4-acetamidobutyl)-4-methyl-3,4-dihydro-5,1,2-benzoxathiazepin-2-yl]methyl]-4-methylphenyl]-3-[3-amino-4-[amino(methyl)amino]-5-methoxyphenyl]propanoic acid (PubChem CID 146312624) has the molecular formula C34H45N5O5S and a molecular weight of 635.83 g/mol. Its IUPAC name is 3-[3-[[7-(4-acetamidobutyl)-4-methyl-3,4-dihydro-5,1,2-benzoxathiazepin-2-yl]methyl]-4-methylphenyl]-3-[3-amino-4-[amino(methyl)amino]-5-methoxyphenyl]propanoic acid.
| Compound Name | 3-[3-[[7-(4-acetamidobutyl)-4-methyl-3,4-dihydro-5,1,2-benzoxathiazepin-2-yl]methyl]-4-methylphenyl]-3-[3-amino-4-[amino(methyl)amino]-5-methoxyphenyl]propanoic acid |
|---|---|
| PubChem CID | 146312624 |
| Molecular Formula | C34H45N5O5S |
| Molecular Weight | 635.83 g/mol |
| Exact Mass | 635.31 |
| IUPAC Name | 3-[3-[[7-(4-acetamidobutyl)-4-methyl-3,4-dihydro-5,1,2-benzoxathiazepin-2-yl]methyl]-4-methylphenyl]-3-[3-amino-4-[amino(methyl)amino]-5-methoxyphenyl]propanoic acid |
| SMILES | COc1cc(C(CC(=O)O)c2ccc(C)c(CN3CC(C)Oc4cc(CCCCNC(C)=O)ccc4S3)c2)cc(N)c1N(C)N |
| InChI | InChI=1S/C34H45N5O5S/c1-21-9-11-25(28(18-33(41)42)26-16-29(35)34(38(4)36)31(17-26)43-5)15-27(21)20-39-19-22(2)44-30-14-24(10-12-32(30)45-39)8-6-7-13-37-23(3)40/h9-12,14-17,22,28H,6-8,13,18-20,35-36H2,1-5H3,(H,37,40)(H,41,42) |
| InChIKey | MYTJPGMEXXRSLB-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 143.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.83 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|