C10H13NO — CID 146312753
4-[(1Z)-buta-1,3-dienyl]-3,5-dimethyl-1,3-dihydropyrrol-2-one (PubChem CID 146312753) has the molecular formula C10H13NO and a molecular weight of 163.22 g/mol. Its IUPAC name is 4-[(1Z)-buta-1,3-dienyl]-3,5-dimethyl-1,3-dihydropyrrol-2-one.
| Compound Name | 4-[(1Z)-buta-1,3-dienyl]-3,5-dimethyl-1,3-dihydropyrrol-2-one |
|---|---|
| PubChem CID | 146312753 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | 4-[(1Z)-buta-1,3-dienyl]-3,5-dimethyl-1,3-dihydropyrrol-2-one |
| SMILES | C=C/C=C\C1=C(C)NC(=O)C1C |
| InChI | InChI=1S/C10H13NO/c1-4-5-6-9-7(2)10(12)11-8(9)3/h4-7H,1H2,2-3H3,(H,11,12)/b6-5- |
| InChIKey | JXCLSXSJWRXUIF-WAYWQWQTSA-N |
| XLogP | 1.77 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|