C15H18F3N6O2S- — CID 146312925
1-(5-amino-1H-1,2,4-triazol-3-yl)-4-[(sulfinatoamino)-[3-(trifluoromethyl)phenyl]methyl]piperidine (PubChem CID 146312925) has the molecular formula C15H18F3N6O2S- and a molecular weight of 403.41 g/mol. Its IUPAC name is 1-(5-amino-1H-1,2,4-triazol-3-yl)-4-[(sulfinatoamino)-[3-(trifluoromethyl)phenyl]methyl]piperidine.
| Compound Name | 1-(5-amino-1H-1,2,4-triazol-3-yl)-4-[(sulfinatoamino)-[3-(trifluoromethyl)phenyl]methyl]piperidine |
|---|---|
| PubChem CID | 146312925 |
| Molecular Formula | C15H18F3N6O2S- |
| Molecular Weight | 403.41 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | 1-(5-amino-1H-1,2,4-triazol-3-yl)-4-[(sulfinatoamino)-[3-(trifluoromethyl)phenyl]methyl]piperidine |
| SMILES | Nc1nc(N2CCC(C(NS(=O)[O-])c3cccc(C(F)(F)F)c3)CC2)n[nH]1 |
| InChI | InChI=1S/C15H19F3N6O2S/c16-15(17,18)11-3-1-2-10(8-11)12(23-27(25)26)9-4-6-24(7-5-9)14-20-13(19)21-22-14/h1-3,8-9,12,23H,4-7H2,(H,25,26)(H3,19,20,21,22)/p-1 |
| InChIKey | XXEBAYZHOPDXER-UHFFFAOYSA-M |
| XLogP | 1.75 |
| TPSA | 122.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.41 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|