C21H37NO2Si2 — CID 14631324
(2E,4E)-3-methyl-5-[(3R,4S)-2,6,6-trimethyl-3,4-bis(trimethylsilyloxy)cyclohexen-1-yl]penta-2,4-dienenitrile (PubChem CID 14631324) has the molecular formula C21H37NO2Si2 and a molecular weight of 391.70 g/mol. Its IUPAC name is (2E,4E)-3-methyl-5-[(3R,4S)-2,6,6-trimethyl-3,4-bis(trimethylsilyloxy)cyclohexen-1-yl]penta-2,4-dienenitrile.
| Compound Name | (2E,4E)-3-methyl-5-[(3R,4S)-2,6,6-trimethyl-3,4-bis(trimethylsilyloxy)cyclohexen-1-yl]penta-2,4-dienenitrile |
|---|---|
| PubChem CID | 14631324 |
| Molecular Formula | C21H37NO2Si2 |
| Molecular Weight | 391.70 g/mol |
| Exact Mass | 391.24 |
| IUPAC Name | (2E,4E)-3-methyl-5-[(3R,4S)-2,6,6-trimethyl-3,4-bis(trimethylsilyloxy)cyclohexen-1-yl]penta-2,4-dienenitrile |
| SMILES | CC1=C(/C=C/C(C)=C/C#N)C(C)(C)C[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C |
| InChI | InChI=1S/C21H37NO2Si2/c1-16(13-14-22)11-12-18-17(2)20(24-26(8,9)10)19(15-21(18,3)4)23-25(5,6)7/h11-13,19-20H,15H2,1-10H3/b12-11+,16-13+/t19-,20+/m0/s1 |
| InChIKey | OBTGPJDIEZCIGM-SLUSEMHXSA-N |
| XLogP | 6.20 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.70 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|