C15H14N2O7S2 — CID 146313388
ethyl (1R,11S)-13-oxo-14-sulfooxy-3-thia-12,14-diazatetracyclo[10.2.1.02,10.04,9]pentadeca-2(10),4,6,8-tetraene-11-carboxylate (PubChem CID 146313388) has the molecular formula C15H14N2O7S2 and a molecular weight of 398.42 g/mol. Its IUPAC name is ethyl (1R,11S)-13-oxo-14-sulfooxy-3-thia-12,14-diazatetracyclo[10.2.1.02,10.04,9]pentadeca-2(10),4,6,8-tetraene-11-carboxylate.
| Compound Name | ethyl (1R,11S)-13-oxo-14-sulfooxy-3-thia-12,14-diazatetracyclo[10.2.1.02,10.04,9]pentadeca-2(10),4,6,8-tetraene-11-carboxylate |
|---|---|
| PubChem CID | 146313388 |
| Molecular Formula | C15H14N2O7S2 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.02 |
| IUPAC Name | ethyl (1R,11S)-13-oxo-14-sulfooxy-3-thia-12,14-diazatetracyclo[10.2.1.02,10.04,9]pentadeca-2(10),4,6,8-tetraene-11-carboxylate |
| SMILES | CCOC(=O)[C@@H]1c2c(sc3ccccc23)[C@H]2CN1C(=O)N2OS(=O)(=O)O |
| InChI | InChI=1S/C15H14N2O7S2/c1-2-23-14(18)12-11-8-5-3-4-6-10(8)25-13(11)9-7-16(12)15(19)17(9)24-26(20,21)22/h3-6,9,12H,2,7H2,1H3,(H,20,21,22)/t9-,12+/m1/s1 |
| InChIKey | MSERIOGOPHBGRA-SKDRFNHKSA-N |
| XLogP | 2.03 |
| TPSA | 113.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|