C16H15N3O3S — CID 146313415
13-oxo-14-prop-2-enoxy-3-thia-12,14-diazatetracyclo[10.2.1.02,10.04,9]pentadeca-2(10),4,6,8-tetraene-11-carboxamide (PubChem CID 146313415) has the molecular formula C16H15N3O3S and a molecular weight of 329.38 g/mol. Its IUPAC name is 13-oxo-14-prop-2-enoxy-3-thia-12,14-diazatetracyclo[10.2.1.02,10.04,9]pentadeca-2(10),4,6,8-tetraene-11-carboxamide.
| Compound Name | 13-oxo-14-prop-2-enoxy-3-thia-12,14-diazatetracyclo[10.2.1.02,10.04,9]pentadeca-2(10),4,6,8-tetraene-11-carboxamide |
|---|---|
| PubChem CID | 146313415 |
| Molecular Formula | C16H15N3O3S |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | 13-oxo-14-prop-2-enoxy-3-thia-12,14-diazatetracyclo[10.2.1.02,10.04,9]pentadeca-2(10),4,6,8-tetraene-11-carboxamide |
| SMILES | C=CCON1C(=O)N2CC1c1sc3ccccc3c1C2C(N)=O |
| InChI | InChI=1S/C16H15N3O3S/c1-2-7-22-19-10-8-18(16(19)21)13(15(17)20)12-9-5-3-4-6-11(9)23-14(10)12/h2-6,10,13H,1,7-8H2,(H2,17,20) |
| InChIKey | YLLSSALXGSRCGP-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|