About (3-benzyl-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 2-oxopropanoate
(3-benzyl-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 2-oxopropanoate (PubChem CID 14631357) has the molecular formula C20H26O3
and a molecular weight of 314.43 g/mol. Its IUPAC name is (3-benzyl-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 2-oxopropanoate.
Molecular Properties
| Compound Name | (3-benzyl-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 2-oxopropanoate |
| PubChem CID | 14631357 |
| Molecular Formula | C20H26O3 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | (3-benzyl-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 2-oxopropanoate |
| SMILES | CC(=O)C(=O)OC1C(Cc2ccccc2)C2CCC1(C)C2(C)C |
| InChI | InChI=1S/C20H26O3/c1-13(21)18(22)23-17-15(12-14-8-6-5-7-9-14)16-10-11-20(17,4)19(16,2)3/h5-9,15-17H,10-12H2,1-4H3 |
| InChIKey | FCRYJZYBSWHWEM-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze (3-benzyl-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 2-oxopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-benzyl-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 2-oxopropanoate?
The IUPAC name of (3-benzyl-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 2-oxopropanoate (CID 14631357) is (3-benzyl-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 2-oxopropanoate.
What is the SMILES notation for (3-benzyl-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 2-oxopropanoate?
The canonical SMILES for (3-benzyl-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 2-oxopropanoate is CC(=O)C(=O)OC1C(Cc2ccccc2)C2CCC1(C)C2(C)C.
What is the InChIKey of (3-benzyl-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 2-oxopropanoate?
The InChIKey is FCRYJZYBSWHWEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26O3/c1-13(21)18(22)23-17-15(12-14-8-6-5-7-9-14)16-10-11-20(17,4)19(16,2)3/h5-9,15-17H,10-12H2,1-4H3.
What are the key properties of (3-benzyl-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 2-oxopropanoate?
(3-benzyl-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 2-oxopropanoate has a molecular weight of 314.43 g/mol, XLogP of 3.80, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-benzyl-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 2-oxopropanoate is sourced from PubChem (CID 14631357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).