About N-[[4-(2,2,2-trifluoroacetyl)morpholin-2-yl]methyl]azetidine-3-carboxamide
N-[[4-(2,2,2-trifluoroacetyl)morpholin-2-yl]methyl]azetidine-3-carboxamide (PubChem CID 146314066) has the molecular formula C11H16F3N3O3
and a molecular weight of 295.26 g/mol. Its IUPAC name is N-[[4-(2,2,2-trifluoroacetyl)morpholin-2-yl]methyl]azetidine-3-carboxamide.
Molecular Properties
| Compound Name | N-[[4-(2,2,2-trifluoroacetyl)morpholin-2-yl]methyl]azetidine-3-carboxamide |
| PubChem CID | 146314066 |
| Molecular Formula | C11H16F3N3O3 |
| Molecular Weight | 295.26 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | N-[[4-(2,2,2-trifluoroacetyl)morpholin-2-yl]methyl]azetidine-3-carboxamide |
| SMILES | O=C(NCC1CN(C(=O)C(F)(F)F)CCO1)C1CNC1 |
| InChI | InChI=1S/C11H16F3N3O3/c12-11(13,14)10(19)17-1-2-20-8(6-17)5-16-9(18)7-3-15-4-7/h7-8,15H,1-6H2,(H,16,18) |
| InChIKey | XMABXJCDAUYHKR-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.26 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[[4-(2,2,2-trifluoroacetyl)morpholin-2-yl]methyl]azetidine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[4-(2,2,2-trifluoroacetyl)morpholin-2-yl]methyl]azetidine-3-carboxamide?
The IUPAC name of N-[[4-(2,2,2-trifluoroacetyl)morpholin-2-yl]methyl]azetidine-3-carboxamide (CID 146314066) is N-[[4-(2,2,2-trifluoroacetyl)morpholin-2-yl]methyl]azetidine-3-carboxamide.
What is the SMILES notation for N-[[4-(2,2,2-trifluoroacetyl)morpholin-2-yl]methyl]azetidine-3-carboxamide?
The canonical SMILES for N-[[4-(2,2,2-trifluoroacetyl)morpholin-2-yl]methyl]azetidine-3-carboxamide is O=C(NCC1CN(C(=O)C(F)(F)F)CCO1)C1CNC1.
What is the InChIKey of N-[[4-(2,2,2-trifluoroacetyl)morpholin-2-yl]methyl]azetidine-3-carboxamide?
The InChIKey is XMABXJCDAUYHKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16F3N3O3/c12-11(13,14)10(19)17-1-2-20-8(6-17)5-16-9(18)7-3-15-4-7/h7-8,15H,1-6H2,(H,16,18).
What are the key properties of N-[[4-(2,2,2-trifluoroacetyl)morpholin-2-yl]methyl]azetidine-3-carboxamide?
N-[[4-(2,2,2-trifluoroacetyl)morpholin-2-yl]methyl]azetidine-3-carboxamide has a molecular weight of 295.26 g/mol, XLogP of -0.89, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[4-(2,2,2-trifluoroacetyl)morpholin-2-yl]methyl]azetidine-3-carboxamide is sourced from PubChem (CID 146314066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).