C15H26N2O6 — CID 146314533
3-[(2-methylpropan-2-yl)oxycarbonyl-(oxan-2-ylmethyl)amino]oxyazetidine-1-carboxylic acid (PubChem CID 146314533) has the molecular formula C15H26N2O6 and a molecular weight of 330.38 g/mol. Its IUPAC name is 3-[(2-methylpropan-2-yl)oxycarbonyl-(oxan-2-ylmethyl)amino]oxyazetidine-1-carboxylic acid.
| Compound Name | 3-[(2-methylpropan-2-yl)oxycarbonyl-(oxan-2-ylmethyl)amino]oxyazetidine-1-carboxylic acid |
|---|---|
| PubChem CID | 146314533 |
| Molecular Formula | C15H26N2O6 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | 3-[(2-methylpropan-2-yl)oxycarbonyl-(oxan-2-ylmethyl)amino]oxyazetidine-1-carboxylic acid |
| SMILES | CC(C)(C)OC(=O)N(CC1CCCCO1)OC1CN(C(=O)O)C1 |
| InChI | InChI=1S/C15H26N2O6/c1-15(2,3)22-14(20)17(10-11-6-4-5-7-21-11)23-12-8-16(9-12)13(18)19/h11-12H,4-10H2,1-3H3,(H,18,19) |
| InChIKey | JGLNKJAVBCABSB-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 88.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|