C20H27BrN6O2 — CID 146314841
2-bromo-N-[4-[(7-methoxy-1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)amino]butyl]-3-methylbutanamide (PubChem CID 146314841) has the molecular formula C20H27BrN6O2 and a molecular weight of 463.38 g/mol. Its IUPAC name is 2-bromo-N-[4-[(7-methoxy-1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)amino]butyl]-3-methylbutanamide.
| Compound Name | 2-bromo-N-[4-[(7-methoxy-1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)amino]butyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 146314841 |
| Molecular Formula | C20H27BrN6O2 |
| Molecular Weight | 463.38 g/mol |
| Exact Mass | 462.14 |
| IUPAC Name | 2-bromo-N-[4-[(7-methoxy-1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)amino]butyl]-3-methylbutanamide |
| SMILES | COc1ccc2c(c1)nc(NCCCCNC(=O)C(Br)C(C)C)c1nnc(C)n12 |
| InChI | InChI=1S/C20H27BrN6O2/c1-12(2)17(21)20(28)23-10-6-5-9-22-18-19-26-25-13(3)27(19)16-8-7-14(29-4)11-15(16)24-18/h7-8,11-12,17H,5-6,9-10H2,1-4H3,(H,22,24)(H,23,28) |
| InChIKey | UTJPUZPLNFCFDX-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 93.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.38 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|