C17H19F3N6O3 — CID 146314846
4-[[7-methoxy-1-methyl-8-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl]amino]butylcarbamic acid (PubChem CID 146314846) has the molecular formula C17H19F3N6O3 and a molecular weight of 412.37 g/mol. Its IUPAC name is 4-[[7-methoxy-1-methyl-8-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl]amino]butylcarbamic acid.
| Compound Name | 4-[[7-methoxy-1-methyl-8-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl]amino]butylcarbamic acid |
|---|---|
| PubChem CID | 146314846 |
| Molecular Formula | C17H19F3N6O3 |
| Molecular Weight | 412.37 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | 4-[[7-methoxy-1-methyl-8-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl]amino]butylcarbamic acid |
| SMILES | COc1cc2nc(NCCCCNC(=O)O)c3nnc(C)n3c2cc1C(F)(F)F |
| InChI | InChI=1S/C17H19F3N6O3/c1-9-24-25-15-14(21-5-3-4-6-22-16(27)28)23-11-8-13(29-2)10(17(18,19)20)7-12(11)26(9)15/h7-8,22H,3-6H2,1-2H3,(H,21,23)(H,27,28) |
| InChIKey | VDAGPVKBNWWLQV-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 113.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.37 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|