C29H40N4O5 — CID 146314999
pentyl 3-methoxy-2-[[2-(5-methyl-6-oxo-1H-pyridin-3-yl)-1-(oxan-4-ylmethyl)benzimidazol-5-yl]methylamino]propanoate (PubChem CID 146314999) has the molecular formula C29H40N4O5 and a molecular weight of 524.66 g/mol. Its IUPAC name is pentyl 3-methoxy-2-[[2-(5-methyl-6-oxo-1H-pyridin-3-yl)-1-(oxan-4-ylmethyl)benzimidazol-5-yl]methylamino]propanoate.
| Compound Name | pentyl 3-methoxy-2-[[2-(5-methyl-6-oxo-1H-pyridin-3-yl)-1-(oxan-4-ylmethyl)benzimidazol-5-yl]methylamino]propanoate |
|---|---|
| PubChem CID | 146314999 |
| Molecular Formula | C29H40N4O5 |
| Molecular Weight | 524.66 g/mol |
| Exact Mass | 524.30 |
| IUPAC Name | pentyl 3-methoxy-2-[[2-(5-methyl-6-oxo-1H-pyridin-3-yl)-1-(oxan-4-ylmethyl)benzimidazol-5-yl]methylamino]propanoate |
| SMILES | CCCCCOC(=O)C(COC)NCc1ccc2c(c1)nc(-c1c[nH]c(=O)c(C)c1)n2CC1CCOCC1 |
| InChI | InChI=1S/C29H40N4O5/c1-4-5-6-11-38-29(35)25(19-36-3)30-16-22-7-8-26-24(15-22)32-27(23-14-20(2)28(34)31-17-23)33(26)18-21-9-12-37-13-10-21/h7-8,14-15,17,21,25,30H,4-6,9-13,16,18-19H2,1-3H3,(H,31,34) |
| InChIKey | JXZUZAYECYQJIV-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 107.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.66 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|