About 4-(1,1-difluoropropan-2-yl)-3,5-bis(1H-indol-4-yl)-1H-pyrrole-2-carboxylic acid
4-(1,1-difluoropropan-2-yl)-3,5-bis(1H-indol-4-yl)-1H-pyrrole-2-carboxylic acid (PubChem CID 146315760) has the molecular formula C24H19F2N3O2
and a molecular weight of 419.43 g/mol. Its IUPAC name is 4-(1,1-difluoropropan-2-yl)-3,5-bis(1H-indol-4-yl)-1H-pyrrole-2-carboxylic acid.
Molecular Properties
| Compound Name | 4-(1,1-difluoropropan-2-yl)-3,5-bis(1H-indol-4-yl)-1H-pyrrole-2-carboxylic acid |
| PubChem CID | 146315760 |
| Molecular Formula | C24H19F2N3O2 |
| Molecular Weight | 419.43 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | 4-(1,1-difluoropropan-2-yl)-3,5-bis(1H-indol-4-yl)-1H-pyrrole-2-carboxylic acid |
| SMILES | CC(c1c(-c2cccc3[nH]ccc23)[nH]c(C(=O)O)c1-c1cccc2[nH]ccc12)C(F)F |
| InChI | InChI=1S/C24H19F2N3O2/c1-12(23(25)26)19-20(15-4-2-6-17-13(15)8-10-27-17)22(24(30)31)29-21(19)16-5-3-7-18-14(16)9-11-28-18/h2-12,23,27-29H,1H3,(H,30,31) |
| InChIKey | JSYDMWDNPWVQQL-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 84.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 419.43 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-(1,1-difluoropropan-2-yl)-3,5-bis(1H-indol-4-yl)-1H-pyrrole-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,1-difluoropropan-2-yl)-3,5-bis(1H-indol-4-yl)-1H-pyrrole-2-carboxylic acid?
The IUPAC name of 4-(1,1-difluoropropan-2-yl)-3,5-bis(1H-indol-4-yl)-1H-pyrrole-2-carboxylic acid (CID 146315760) is 4-(1,1-difluoropropan-2-yl)-3,5-bis(1H-indol-4-yl)-1H-pyrrole-2-carboxylic acid.
What is the SMILES notation for 4-(1,1-difluoropropan-2-yl)-3,5-bis(1H-indol-4-yl)-1H-pyrrole-2-carboxylic acid?
The canonical SMILES for 4-(1,1-difluoropropan-2-yl)-3,5-bis(1H-indol-4-yl)-1H-pyrrole-2-carboxylic acid is CC(c1c(-c2cccc3[nH]ccc23)[nH]c(C(=O)O)c1-c1cccc2[nH]ccc12)C(F)F.
What is the InChIKey of 4-(1,1-difluoropropan-2-yl)-3,5-bis(1H-indol-4-yl)-1H-pyrrole-2-carboxylic acid?
The InChIKey is JSYDMWDNPWVQQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H19F2N3O2/c1-12(23(25)26)19-20(15-4-2-6-17-13(15)8-10-27-17)22(24(30)31)29-21(19)16-5-3-7-18-14(16)9-11-28-18/h2-12,23,27-29H,1H3,(H,30,31).
What are the key properties of 4-(1,1-difluoropropan-2-yl)-3,5-bis(1H-indol-4-yl)-1H-pyrrole-2-carboxylic acid?
4-(1,1-difluoropropan-2-yl)-3,5-bis(1H-indol-4-yl)-1H-pyrrole-2-carboxylic acid has a molecular weight of 419.43 g/mol, XLogP of 6.38, 5 rotatable bonds, 4 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,1-difluoropropan-2-yl)-3,5-bis(1H-indol-4-yl)-1H-pyrrole-2-carboxylic acid is sourced from PubChem (CID 146315760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).