C18H20FNO3 — CID 146316508
N-ethyl-N-(3-fluorophenyl)-2,4-dihydroxy-5-propan-2-ylbenzamide (PubChem CID 146316508) has the molecular formula C18H20FNO3 and a molecular weight of 317.36 g/mol. Its IUPAC name is N-ethyl-N-(3-fluorophenyl)-2,4-dihydroxy-5-propan-2-ylbenzamide.
| Compound Name | N-ethyl-N-(3-fluorophenyl)-2,4-dihydroxy-5-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 146316508 |
| Molecular Formula | C18H20FNO3 |
| Molecular Weight | 317.36 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | N-ethyl-N-(3-fluorophenyl)-2,4-dihydroxy-5-propan-2-ylbenzamide |
| SMILES | CCN(C(=O)c1cc(C(C)C)c(O)cc1O)c1cccc(F)c1 |
| InChI | InChI=1S/C18H20FNO3/c1-4-20(13-7-5-6-12(19)8-13)18(23)15-9-14(11(2)3)16(21)10-17(15)22/h5-11,21-22H,4H2,1-3H3 |
| InChIKey | HFPNOGIAYHWBFZ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.36 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |